C13H13FN2O — CID 106884727
6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-1H-pyrimidin-2-one (PubChem CID 106884727) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-1H-pyrimidin-2-one.
| Compound Name | 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 106884727 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 6-(2-fluoro-4,6-dimethylphenyl)-5-methyl-1H-pyrimidin-2-one |
| SMILES | Cc1cc(C)c(-c2[nH]c(=O)ncc2C)c(F)c1 |
| InChI | InChI=1S/C13H13FN2O/c1-7-4-8(2)11(10(14)5-7)12-9(3)6-15-13(17)16-12/h4-6H,1-3H3,(H,15,16,17) |
| InChIKey | LPIQDKVHBSJLTA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |