C13H11F2N — CID 106882652
4-fluoro-2-(2-fluoro-4,6-dimethylphenyl)pyridine (PubChem CID 106882652) has the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. Its IUPAC name is 4-fluoro-2-(2-fluoro-4,6-dimethylphenyl)pyridine.
| Compound Name | 4-fluoro-2-(2-fluoro-4,6-dimethylphenyl)pyridine |
|---|---|
| PubChem CID | 106882652 |
| Molecular Formula | C13H11F2N |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-fluoro-2-(2-fluoro-4,6-dimethylphenyl)pyridine |
| SMILES | Cc1cc(C)c(-c2cc(F)ccn2)c(F)c1 |
| InChI | InChI=1S/C13H11F2N/c1-8-5-9(2)13(11(15)6-8)12-7-10(14)3-4-16-12/h3-7H,1-2H3 |
| InChIKey | XAKRIHSKMFCLOH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |