C12H16Cl2N2O2 — CID 106890894
3,5-dichloro-4-(3,4-dimethoxypyrrolidin-1-yl)aniline (PubChem CID 106890894) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 3,5-dichloro-4-(3,4-dimethoxypyrrolidin-1-yl)aniline.
| Compound Name | 3,5-dichloro-4-(3,4-dimethoxypyrrolidin-1-yl)aniline |
|---|---|
| PubChem CID | 106890894 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3,5-dichloro-4-(3,4-dimethoxypyrrolidin-1-yl)aniline |
| SMILES | COC1CN(c2c(Cl)cc(N)cc2Cl)CC1OC |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-17-10-5-16(6-11(10)18-2)12-8(13)3-7(15)4-9(12)14/h3-4,10-11H,5-6,15H2,1-2H3 |
| InChIKey | WHHXIUNUCLWIJI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|