C12H12Cl2N2O3 — CID 106892004
1-(2,6-dichloro-4-nitrophenyl)piperidine-2-carbaldehyde (PubChem CID 106892004) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.14 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-nitrophenyl)piperidine-2-carbaldehyde.
| Compound Name | 1-(2,6-dichloro-4-nitrophenyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 106892004 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 1-(2,6-dichloro-4-nitrophenyl)piperidine-2-carbaldehyde |
| SMILES | O=CC1CCCCN1c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O3/c13-10-5-9(16(18)19)6-11(14)12(10)15-4-2-1-3-8(15)7-17/h5-8H,1-4H2 |
| InChIKey | NDGGLJWQIIUNBH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|