C11H5BrN2O3S — CID 106923003
5-bromo-6-(1,3-oxazol-2-ylsulfanyl)-1H-indole-2,3-dione (PubChem CID 106923003) has the molecular formula C11H5BrN2O3S and a molecular weight of 325.14 g/mol. Its IUPAC name is 5-bromo-6-(1,3-oxazol-2-ylsulfanyl)-1H-indole-2,3-dione.
| Compound Name | 5-bromo-6-(1,3-oxazol-2-ylsulfanyl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 106923003 |
| Molecular Formula | C11H5BrN2O3S |
| Molecular Weight | 325.14 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | 5-bromo-6-(1,3-oxazol-2-ylsulfanyl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cc(Sc3ncco3)c(Br)cc2C1=O |
| InChI | InChI=1S/C11H5BrN2O3S/c12-6-3-5-7(14-10(16)9(5)15)4-8(6)18-11-13-1-2-17-11/h1-4H,(H,14,15,16) |
| InChIKey | VGKQDJYBIIXXTK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|