C12H10BrNO4S — CID 79335840
methyl 3-[(5-bromo-2,3-dioxo-1H-indol-6-yl)sulfanyl]propanoate (PubChem CID 79335840) has the molecular formula C12H10BrNO4S and a molecular weight of 344.19 g/mol. Its IUPAC name is methyl 3-[(5-bromo-2,3-dioxo-1H-indol-6-yl)sulfanyl]propanoate.
| Compound Name | methyl 3-[(5-bromo-2,3-dioxo-1H-indol-6-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 79335840 |
| Molecular Formula | C12H10BrNO4S |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | methyl 3-[(5-bromo-2,3-dioxo-1H-indol-6-yl)sulfanyl]propanoate |
| SMILES | COC(=O)CCSc1cc2c(cc1Br)C(=O)C(=O)N2 |
| InChI | InChI=1S/C12H10BrNO4S/c1-18-10(15)2-3-19-9-5-8-6(4-7(9)13)11(16)12(17)14-8/h4-5H,2-3H2,1H3,(H,14,16,17) |
| InChIKey | TXNZLTCYJHSAQW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|