C7H12N2OS — CID 106923813
2-(1,3-oxazol-2-ylsulfanyl)butan-1-amine (PubChem CID 106923813) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-ylsulfanyl)butan-1-amine.
| Compound Name | 2-(1,3-oxazol-2-ylsulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 106923813 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(1,3-oxazol-2-ylsulfanyl)butan-1-amine |
| SMILES | CCC(CN)Sc1ncco1 |
| InChI | InChI=1S/C7H12N2OS/c1-2-6(5-8)11-7-9-3-4-10-7/h3-4,6H,2,5,8H2,1H3 |
| InChIKey | XTUDHLYIUIELRD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |