C14H13FN2OS — CID 106924410
3-[5-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-amine (PubChem CID 106924410) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[5-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[5-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 106924410 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[5-fluoro-2-[(4-methyl-1,3-oxazol-2-yl)sulfanylmethyl]phenyl]prop-2-yn-1-amine |
| SMILES | Cc1coc(SCc2ccc(F)cc2C#CCN)n1 |
| InChI | InChI=1S/C14H13FN2OS/c1-10-8-18-14(17-10)19-9-12-4-5-13(15)7-11(12)3-2-6-16/h4-5,7-8H,6,9,16H2,1H3 |
| InChIKey | UNNDEFORSNWMJO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|