C16H20FNS — CID 63120077
3-[2-(cyclopentylmethylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-amine (PubChem CID 63120077) has the molecular formula C16H20FNS and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[2-(cyclopentylmethylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-amine.
| Compound Name | 3-[2-(cyclopentylmethylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 63120077 |
| Molecular Formula | C16H20FNS |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-[2-(cyclopentylmethylsulfanylmethyl)-5-fluorophenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1cc(F)ccc1CSCC1CCCC1 |
| InChI | InChI=1S/C16H20FNS/c17-16-8-7-15(14(10-16)6-3-9-18)12-19-11-13-4-1-2-5-13/h7-8,10,13H,1-2,4-5,9,11-12,18H2 |
| InChIKey | BQRNYRUWSCTGOK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|