C9H15I2NO — CID 10692748
2-(iodomethyl)-2-methyl-5,6,7,8-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridin-4-ium iodide (PubChem CID 10692748) has the molecular formula C9H15I2NO and a molecular weight of 407.03 g/mol. Its IUPAC name is 2-(iodomethyl)-2-methyl-5,6,7,8-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridin-4-ium iodide.
| Compound Name | 2-(iodomethyl)-2-methyl-5,6,7,8-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridin-4-ium iodide |
|---|---|
| PubChem CID | 10692748 |
| Molecular Formula | C9H15I2NO |
| Molecular Weight | 407.03 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | 2-(iodomethyl)-2-methyl-5,6,7,8-tetrahydro-3H-[1,3]oxazolo[3,2-a]pyridin-4-ium iodide |
| SMILES | CC1(CI)C[N+]2=C(CCCC2)O1.[I-] |
| InChI | InChI=1S/C9H15INO.HI/c1-9(6-10)7-11-5-3-2-4-8(11)12-9;/h2-7H2,1H3;1H/q+1;/p-1 |
| InChIKey | XQJPZDLDPHAGRD-UHFFFAOYSA-M |
| XLogP | -1.19 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.03 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|