C27H42OSi — CID 10692950
(3E,5E,7E)-1-(4-decylphenyl)-8-trimethylsilylocta-3,5,7-trien-2-one (PubChem CID 10692950) has the molecular formula C27H42OSi and a molecular weight of 410.72 g/mol. Its IUPAC name is (3E,5E,7E)-1-(4-decylphenyl)-8-trimethylsilylocta-3,5,7-trien-2-one.
| Compound Name | (3E,5E,7E)-1-(4-decylphenyl)-8-trimethylsilylocta-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 10692950 |
| Molecular Formula | C27H42OSi |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | (3E,5E,7E)-1-(4-decylphenyl)-8-trimethylsilylocta-3,5,7-trien-2-one |
| SMILES | CCCCCCCCCCc1ccc(CC(=O)/C=C/C=C/C=C/[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C27H42OSi/c1-5-6-7-8-9-10-11-14-17-25-19-21-26(22-20-25)24-27(28)18-15-12-13-16-23-29(2,3)4/h12-13,15-16,18-23H,5-11,14,17,24H2,1-4H3/b13-12+,18-15+,23-16+ |
| InChIKey | DZZTWRJPQIBPHP-QENXVXHPSA-N |
| XLogP | 8.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|