C13H14ClN3O2 — CID 106934163
3-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 106934163) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 3-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 106934163 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | NCCn1c(=O)ccn(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C13H14ClN3O2/c14-11-3-1-10(2-4-11)9-16-7-5-12(18)17(8-6-15)13(16)19/h1-5,7H,6,8-9,15H2 |
| InChIKey | SSNTWTCZUUNTGQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |