C21H31N3O6 — CID 10693476
3-methyl-2-[[(1S)-1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-phenylethyl]carbamoyl]butanoic acid (PubChem CID 10693476) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is 3-methyl-2-[[(1S)-1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-phenylethyl]carbamoyl]butanoic acid.
| Compound Name | 3-methyl-2-[[(1S)-1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-phenylethyl]carbamoyl]butanoic acid |
|---|---|
| PubChem CID | 10693476 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 3-methyl-2-[[(1S)-1-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-2-phenylethyl]carbamoyl]butanoic acid |
| SMILES | CC(C)C(C(=O)O)C(=O)NC(Cc1ccccc1)NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N3O6/c1-13(2)17(19(27)28)18(26)24-15(11-14-9-7-6-8-10-14)23-16(25)12-22-20(29)30-21(3,4)5/h6-10,13,15,17H,11-12H2,1-5H3,(H,22,29)(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | IGPWIGBYFNBQRH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|