C23H24ClN3O3 — CID 10693692
benzyl 2-[5-chloro-3-[(2-methyl-1-phenylpropan-2-yl)amino]-2-oxopyrazin-1-yl]acetate (PubChem CID 10693692) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is benzyl 2-[5-chloro-3-[(2-methyl-1-phenylpropan-2-yl)amino]-2-oxopyrazin-1-yl]acetate.
| Compound Name | benzyl 2-[5-chloro-3-[(2-methyl-1-phenylpropan-2-yl)amino]-2-oxopyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 10693692 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | benzyl 2-[5-chloro-3-[(2-methyl-1-phenylpropan-2-yl)amino]-2-oxopyrazin-1-yl]acetate |
| SMILES | CC(C)(Cc1ccccc1)Nc1nc(Cl)cn(CC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C23H24ClN3O3/c1-23(2,13-17-9-5-3-6-10-17)26-21-22(29)27(14-19(24)25-21)15-20(28)30-16-18-11-7-4-8-12-18/h3-12,14H,13,15-16H2,1-2H3,(H,25,26) |
| InChIKey | DIFNYBASNHUVBY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |