C24H50O3Si2 — CID 10694523
4-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]butan-1-ol (PubChem CID 10694523) has the molecular formula C24H50O3Si2 and a molecular weight of 442.83 g/mol. Its IUPAC name is 4-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]butan-1-ol.
| Compound Name | 4-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]butan-1-ol |
|---|---|
| PubChem CID | 10694523 |
| Molecular Formula | C24H50O3Si2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | 4-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]butan-1-ol |
| SMILES | C=C(C)[C@@]1(O[Si](CC)(CC)CC)CC[C@@]1(CCCCO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O3Si2/c1-11-29(12-2,13-3)27-24(21(4)5)18-17-23(24,16-14-15-19-25)20-26-28(9,10)22(6,7)8/h25H,4,11-20H2,1-3,5-10H3/t23-,24-/m0/s1 |
| InChIKey | IKQPMRKWSXSDNE-ZEQRLZLVSA-N |
| XLogP | 7.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|