C25H48Br2O2Si2 — CID 15188015
tert-butyl-[[(1S,2S)-1-(5,5-dibromopent-4-enyl)-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]methoxy]-dimethylsilane (PubChem CID 15188015) has the molecular formula C25H48Br2O2Si2 and a molecular weight of 596.64 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S)-1-(5,5-dibromopent-4-enyl)-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S)-1-(5,5-dibromopent-4-enyl)-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 15188015 |
| Molecular Formula | C25H48Br2O2Si2 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | tert-butyl-[[(1S,2S)-1-(5,5-dibromopent-4-enyl)-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]methoxy]-dimethylsilane |
| SMILES | C=C(C)[C@@]1(O[Si](CC)(CC)CC)CC[C@@]1(CCCC=C(Br)Br)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48Br2O2Si2/c1-11-31(12-2,13-3)29-25(21(4)5)19-18-24(25,17-15-14-16-22(26)27)20-28-30(9,10)23(6,7)8/h16H,4,11-15,17-20H2,1-3,5-10H3/t24-,25-/m0/s1 |
| InChIKey | XMYAUMYZFQYPCE-DQEYMECFSA-N |
| XLogP | 9.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|