C27H50O4Si2 — CID 11092244
methyl 6-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]hex-2-ynoate (PubChem CID 11092244) has the molecular formula C27H50O4Si2 and a molecular weight of 494.87 g/mol. Its IUPAC name is methyl 6-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]hex-2-ynoate.
| Compound Name | methyl 6-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]hex-2-ynoate |
|---|---|
| PubChem CID | 11092244 |
| Molecular Formula | C27H50O4Si2 |
| Molecular Weight | 494.87 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | methyl 6-[(1S,2S)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-1-en-2-yl-2-triethylsilyloxycyclobutyl]hex-2-ynoate |
| SMILES | C=C(C)[C@@]1(O[Si](CC)(CC)CC)CC[C@@]1(CCCC#CC(=O)OC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O4Si2/c1-12-33(13-2,14-3)31-27(23(4)5)21-20-26(27,19-17-15-16-18-24(28)29-9)22-30-32(10,11)25(6,7)8/h4,12-15,17,19-22H2,1-3,5-11H3/t26-,27-/m0/s1 |
| InChIKey | YNKYVBBLHDYNAQ-SVBPBHIXSA-N |
| XLogP | 7.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.87 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|