C11H11BrN2O — CID 106952204
2-[(3-bromophenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one (PubChem CID 106952204) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one.
| Compound Name | 2-[(3-bromophenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one |
|---|---|
| PubChem CID | 106952204 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-4-methyl-1,4-dihydroimidazol-5-one |
| SMILES | CC1N=C(Cc2cccc(Br)c2)NC1=O |
| InChI | InChI=1S/C11H11BrN2O/c1-7-11(15)14-10(13-7)6-8-3-2-4-9(12)5-8/h2-5,7H,6H2,1H3,(H,13,14,15) |
| InChIKey | KEGGTIJSHBSGPM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |