C24H32O9 — CID 10695440
[(2R,3R,5S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxycyclohexyl]methyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 10695440) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is [(2R,3R,5S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxycyclohexyl]methyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(2R,3R,5S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxycyclohexyl]methyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 10695440 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(2R,3R,5S,6R)-2,3,5,6-tetrahydroxy-4-phenylmethoxycyclohexyl]methyl (1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)OCC1[C@@H](O)[C@H](O)C(OCc3ccccc3)[C@H](O)[C@@H]1O)OC2=O |
| InChI | InChI=1S/C24H32O9/c1-22(2)23(3)9-10-24(22,33-20(23)29)21(30)32-12-14-15(25)17(27)19(18(28)16(14)26)31-11-13-7-5-4-6-8-13/h4-8,14-19,25-28H,9-12H2,1-3H3/t14?,15-,16-,17-,18+,19?,23+,24-/m1/s1 |
| InChIKey | NGIKPBHBAKDLSD-CDBADGIISA-N |
| XLogP | 0.31 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |