C11H20N4O3S — CID 106964756
5-[(2-methoxyethylamino)methyl]-N-(1-oxothian-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 106964756) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-(1-oxothian-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-(1-oxothian-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106964756 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-(1-oxothian-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | COCCNCc1nnc(NC2CCS(=O)CC2)o1 |
| InChI | InChI=1S/C11H20N4O3S/c1-17-5-4-12-8-10-14-15-11(18-10)13-9-2-6-19(16)7-3-9/h9,12H,2-8H2,1H3,(H,13,15) |
| InChIKey | WOAVSWITNXOOLL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|