C31H50O3Si — CID 10696672
(Z,1S)-1-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol (PubChem CID 10696672) has the molecular formula C31H50O3Si and a molecular weight of 498.82 g/mol. Its IUPAC name is (Z,1S)-1-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol.
| Compound Name | (Z,1S)-1-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol |
|---|---|
| PubChem CID | 10696672 |
| Molecular Formula | C31H50O3Si |
| Molecular Weight | 498.82 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | (Z,1S)-1-[(1R)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-2,2,4-trimethylcyclohex-3-en-1-yl]-7-tri(propan-2-yl)silylhept-4-en-2,6-diyn-1-ol |
| SMILES | CC1=C(C2OCC(C)(C)CO2)C(C)(C)[C@H]([C@H](O)C#C/C=C\C#C[Si](C(C)C)(C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C31H50O3Si/c1-22(2)35(23(3)4,24(5)6)19-15-13-12-14-16-27(32)26-18-17-25(7)28(31(26,10)11)29-33-20-30(8,9)21-34-29/h12-13,22-24,26-27,29,32H,17-18,20-21H2,1-11H3/b13-12-/t26-,27+/m0/s1 |
| InChIKey | CGFBLPLUFIRKFI-PSZNLEPHSA-N |
| XLogP | 7.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.82 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|