C15H19ClF3NO — CID 106971445
1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,3,5-trimethylcyclohexan-1-ol (PubChem CID 106971445) has the molecular formula C15H19ClF3NO and a molecular weight of 321.77 g/mol. Its IUPAC name is 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,3,5-trimethylcyclohexan-1-ol.
| Compound Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,3,5-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 106971445 |
| Molecular Formula | C15H19ClF3NO |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[2-chloro-6-(trifluoromethyl)-3-pyridinyl]-3,3,5-trimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CC(O)(c2ccc(C(F)(F)F)nc2Cl)C1 |
| InChI | InChI=1S/C15H19ClF3NO/c1-9-6-13(2,3)8-14(21,7-9)10-4-5-11(15(17,18)19)20-12(10)16/h4-5,9,21H,6-8H2,1-3H3 |
| InChIKey | IYNVMABNHNIUKZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|