C32H26AsBF4 — CID 10698314
2,2-diphenylethenyl(triphenyl)arsanium tetrafluoroborate (PubChem CID 10698314) has the molecular formula C32H26AsBF4 and a molecular weight of 572.29 g/mol. Its IUPAC name is 2,2-diphenylethenyl(triphenyl)arsanium tetrafluoroborate.
| Compound Name | 2,2-diphenylethenyl(triphenyl)arsanium tetrafluoroborate |
|---|---|
| PubChem CID | 10698314 |
| Molecular Formula | C32H26AsBF4 |
| Molecular Weight | 572.29 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 2,2-diphenylethenyl(triphenyl)arsanium tetrafluoroborate |
| SMILES | C(=C(c1ccccc1)c1ccccc1)[As+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C32H26As.BF4/c1-6-16-27(17-7-1)32(28-18-8-2-9-19-28)26-33(29-20-10-3-11-21-29,30-22-12-4-13-23-30)31-24-14-5-15-25-31;2-1(3,4)5/h1-26H;/q+1;-1 |
| InChIKey | XZDABIQFDVQKPL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.29 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|