C11H21NO6 — CID 106993163
4-hydroxy-5-(2-methoxyethoxy)-2-methyl-2-(methylcarbamoyl)pentanoic acid (PubChem CID 106993163) has the molecular formula C11H21NO6 and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-hydroxy-5-(2-methoxyethoxy)-2-methyl-2-(methylcarbamoyl)pentanoic acid.
| Compound Name | 4-hydroxy-5-(2-methoxyethoxy)-2-methyl-2-(methylcarbamoyl)pentanoic acid |
|---|---|
| PubChem CID | 106993163 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-hydroxy-5-(2-methoxyethoxy)-2-methyl-2-(methylcarbamoyl)pentanoic acid |
| SMILES | CNC(=O)C(C)(CC(O)COCCOC)C(=O)O |
| InChI | InChI=1S/C11H21NO6/c1-11(10(15)16,9(14)12-2)6-8(13)7-18-5-4-17-3/h8,13H,4-7H2,1-3H3,(H,12,14)(H,15,16) |
| InChIKey | ACXWELMZTWEDMT-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|