C33H60N4O11 — CID 10699801
(2R)-2-amino-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]hexanoic acid (PubChem CID 10699801) has the molecular formula C33H60N4O11 and a molecular weight of 688.86 g/mol. Its IUPAC name is (2R)-2-amino-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]hexanoic acid.
| Compound Name | (2R)-2-amino-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 10699801 |
| Molecular Formula | C33H60N4O11 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 688.43 |
| IUPAC Name | (2R)-2-amino-6-[2,3-bis[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)CN(CC(=O)OC(C)(C)C)CC(C(=O)NCCCC[C@@H](N)C(=O)O)N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H60N4O11/c1-30(2,3)45-24(38)18-36(19-25(39)46-31(4,5)6)17-23(28(42)35-16-14-13-15-22(34)29(43)44)37(20-26(40)47-32(7,8)9)21-27(41)48-33(10,11)12/h22-23H,13-21,34H2,1-12H3,(H,35,42)(H,43,44)/t22-,23?/m1/s1 |
| InChIKey | TZCBVTQOGMZCFV-WTQRLHSKSA-N |
| XLogP | 2.02 |
| TPSA | 204.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|