C10H14N2OS — CID 107011091
1-(1,2,5-thiadiazol-3-yl)oct-7-en-1-one (PubChem CID 107011091) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(1,2,5-thiadiazol-3-yl)oct-7-en-1-one.
| Compound Name | 1-(1,2,5-thiadiazol-3-yl)oct-7-en-1-one |
|---|---|
| PubChem CID | 107011091 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(1,2,5-thiadiazol-3-yl)oct-7-en-1-one |
| SMILES | C=CCCCCCC(=O)c1cnsn1 |
| InChI | InChI=1S/C10H14N2OS/c1-2-3-4-5-6-7-10(13)9-8-11-14-12-9/h2,8H,1,3-7H2 |
| InChIKey | HRGZFLAECCCNDX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|