C8H12O3 — CID 10702056
4-methoxy-2,5-dimethyl-2,3-dihydropyran-6-one (PubChem CID 10702056) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-methoxy-2,5-dimethyl-2,3-dihydropyran-6-one.
| Compound Name | 4-methoxy-2,5-dimethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10702056 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-methoxy-2,5-dimethyl-2,3-dihydropyran-6-one |
| SMILES | COC1=C(C)C(=O)OC(C)C1 |
| InChI | InChI=1S/C8H12O3/c1-5-4-7(10-3)6(2)8(9)11-5/h5H,4H2,1-3H3 |
| InChIKey | IXZWBWCCRQYVLB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |