C9H12OS — CID 10702268
4,5,6,7-tetrahydro-1-benzothiophen-6-ylmethanol (PubChem CID 10702268) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophen-6-ylmethanol.
| Compound Name | 4,5,6,7-tetrahydro-1-benzothiophen-6-ylmethanol |
|---|---|
| PubChem CID | 10702268 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 4,5,6,7-tetrahydro-1-benzothiophen-6-ylmethanol |
| SMILES | OCC1CCc2ccsc2C1 |
| InChI | InChI=1S/C9H12OS/c10-6-7-1-2-8-3-4-11-9(8)5-7/h3-4,7,10H,1-2,5-6H2 |
| InChIKey | UNOSWVWANPIJMS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |