C8H17NO2S — CID 107029573
N-(1-hydroxypropan-2-yl)-3-methyl-2-sulfanylbutanamide (PubChem CID 107029573) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107029573 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(CO)NC(=O)C(S)C(C)C |
| InChI | InChI=1S/C8H17NO2S/c1-5(2)7(12)8(11)9-6(3)4-10/h5-7,10,12H,4H2,1-3H3,(H,9,11) |
| InChIKey | JVNXZTMNIQSVNO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|