C12H10N2O — CID 10703102
3-methyl-6-phenylimidazo[2,1-b][1,3]oxazole (PubChem CID 10703102) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-methyl-6-phenylimidazo[2,1-b][1,3]oxazole.
| Compound Name | 3-methyl-6-phenylimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 10703102 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-methyl-6-phenylimidazo[2,1-b][1,3]oxazole |
| SMILES | Cc1coc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C12H10N2O/c1-9-8-15-12-13-11(7-14(9)12)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | UTGGOKNLTHTTPY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |