C11H9N3Se — CID 621889
2-methyl-6-phenylimidazo[2,1-b][1,3,4]selenadiazole (PubChem CID 621889) has the molecular formula C11H9N3Se and a molecular weight of 262.17 g/mol. Its IUPAC name is 2-methyl-6-phenylimidazo[2,1-b][1,3,4]selenadiazole.
| Compound Name | 2-methyl-6-phenylimidazo[2,1-b][1,3,4]selenadiazole |
|---|---|
| PubChem CID | 621889 |
| Molecular Formula | C11H9N3Se |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2-methyl-6-phenylimidazo[2,1-b][1,3,4]selenadiazole |
| SMILES | Cc1nn2cc(-c3ccccc3)nc2[se]1 |
| InChI | InChI=1S/C11H9N3Se/c1-8-13-14-7-10(12-11(14)15-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | RNEJEIMFVTYPKP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|