C23H16N2Se — CID 14721958
2,3,6-triphenylimidazo[2,1-b][1,3]selenazole (PubChem CID 14721958) has the molecular formula C23H16N2Se and a molecular weight of 399.36 g/mol. Its IUPAC name is 2,3,6-triphenylimidazo[2,1-b][1,3]selenazole.
| Compound Name | 2,3,6-triphenylimidazo[2,1-b][1,3]selenazole |
|---|---|
| PubChem CID | 14721958 |
| Molecular Formula | C23H16N2Se |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2,3,6-triphenylimidazo[2,1-b][1,3]selenazole |
| SMILES | c1ccc(-c2cn3c(-c4ccccc4)c(-c4ccccc4)[se]c3n2)cc1 |
| InChI | InChI=1S/C23H16N2Se/c1-4-10-17(11-5-1)20-16-25-21(18-12-6-2-7-13-18)22(26-23(25)24-20)19-14-8-3-9-15-19/h1-16H |
| InChIKey | QJPUOENHIRIRFA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|