About ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite
ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite (PubChem CID 167444701) has the molecular formula C12H15FN2S
and a molecular weight of 238.33 g/mol. Its IUPAC name is ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite.
Molecular Properties
| Compound Name | ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite |
| PubChem CID | 167444701 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite |
| SMILES | CC.Cc1nc(-c2ccccc2)cn1SF |
| InChI | InChI=1S/C10H9FN2S.C2H6/c1-8-12-10(7-13(8)14-11)9-5-3-2-4-6-9;1-2/h2-7H,1H3;1-2H3 |
| InChIKey | IIPFPDPAVYTOKM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite?
The IUPAC name of ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite (CID 167444701) is ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite.
What is the SMILES notation for ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite?
The canonical SMILES for ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite is CC.Cc1nc(-c2ccccc2)cn1SF.
What is the InChIKey of ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite?
The InChIKey is IIPFPDPAVYTOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2S.C2H6/c1-8-12-10(7-13(8)14-11)9-5-3-2-4-6-9;1-2/h2-7H,1H3;1-2H3.
What are the key properties of ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite?
ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite has a molecular weight of 238.33 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methyl-4-phenylimidazol-1-yl) thiohypofluorite is sourced from PubChem (CID 167444701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).