C14H18O — CID 10703299
(1S,2S,4R,7S)-2-(4-methylphenyl)bicyclo[2.2.1]heptan-7-ol (PubChem CID 10703299) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (1S,2S,4R,7S)-2-(4-methylphenyl)bicyclo[2.2.1]heptan-7-ol.
| Compound Name | (1S,2S,4R,7S)-2-(4-methylphenyl)bicyclo[2.2.1]heptan-7-ol |
|---|---|
| PubChem CID | 10703299 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1S,2S,4R,7S)-2-(4-methylphenyl)bicyclo[2.2.1]heptan-7-ol |
| SMILES | Cc1ccc([C@H]2C[C@H]3CC[C@@H]2[C@H]3O)cc1 |
| InChI | InChI=1S/C14H18O/c1-9-2-4-10(5-3-9)13-8-11-6-7-12(13)14(11)15/h2-5,11-15H,6-8H2,1H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | SDFNSUUWJKZSJC-RQJABVFESA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |