C15H13Br2NO2S — CID 107037069
N-(2,4-dibromo-5-methoxyphenyl)-2-(4-sulfanylphenyl)acetamide (PubChem CID 107037069) has the molecular formula C15H13Br2NO2S and a molecular weight of 431.15 g/mol. Its IUPAC name is N-(2,4-dibromo-5-methoxyphenyl)-2-(4-sulfanylphenyl)acetamide.
| Compound Name | N-(2,4-dibromo-5-methoxyphenyl)-2-(4-sulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 107037069 |
| Molecular Formula | C15H13Br2NO2S |
| Molecular Weight | 431.15 g/mol |
| Exact Mass | 428.90 |
| IUPAC Name | N-(2,4-dibromo-5-methoxyphenyl)-2-(4-sulfanylphenyl)acetamide |
| SMILES | COc1cc(NC(=O)Cc2ccc(S)cc2)c(Br)cc1Br |
| InChI | InChI=1S/C15H13Br2NO2S/c1-20-14-8-13(11(16)7-12(14)17)18-15(19)6-9-2-4-10(21)5-3-9/h2-5,7-8,21H,6H2,1H3,(H,18,19) |
| InChIKey | XIEFEDFDUVNGSY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.15 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|