C7H9N5OS — CID 10703711
N-(5-methyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydroxylamine (PubChem CID 10703711) has the molecular formula C7H9N5OS and a molecular weight of 211.25 g/mol. Its IUPAC name is N-(5-methyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydroxylamine.
| Compound Name | N-(5-methyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydroxylamine |
|---|---|
| PubChem CID | 10703711 |
| Molecular Formula | C7H9N5OS |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | N-(5-methyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydroxylamine |
| SMILES | CSc1nc2nc(C)cc(NO)n2n1 |
| InChI | InChI=1S/C7H9N5OS/c1-4-3-5(11-13)12-6(8-4)9-7(10-12)14-2/h3,11,13H,1-2H3 |
| InChIKey | NCZZGGTVDFWIEB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|