C10H14O5 — CID 10703823
8-hydroperoxy-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (PubChem CID 10703823) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 8-hydroperoxy-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
| Compound Name | 8-hydroperoxy-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 10703823 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 8-hydroperoxy-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
| SMILES | CC1(C)OC(=O)C2=C(O1)C(OO)CCC2 |
| InChI | InChI=1S/C10H14O5/c1-10(2)13-8-6(9(11)14-10)4-3-5-7(8)15-12/h7,12H,3-5H2,1-2H3 |
| InChIKey | GWRSUBLIPJNAKJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|