C20H26O7 — CID 10691048
8-[(2,2-dimethyl-4-oxo-5,6,7,8-tetrahydro-1,3-benzodioxin-8-yl)oxy]-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (PubChem CID 10691048) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 8-[(2,2-dimethyl-4-oxo-5,6,7,8-tetrahydro-1,3-benzodioxin-8-yl)oxy]-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
| Compound Name | 8-[(2,2-dimethyl-4-oxo-5,6,7,8-tetrahydro-1,3-benzodioxin-8-yl)oxy]-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 10691048 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 8-[(2,2-dimethyl-4-oxo-5,6,7,8-tetrahydro-1,3-benzodioxin-8-yl)oxy]-2,2-dimethyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one |
| SMILES | CC1(C)OC(=O)C2=C(O1)C(OC1CCCC3=C1OC(C)(C)OC3=O)CCC2 |
| InChI | InChI=1S/C20H26O7/c1-19(2)24-15-11(17(21)26-19)7-5-9-13(15)23-14-10-6-8-12-16(14)25-20(3,4)27-18(12)22/h13-14H,5-10H2,1-4H3 |
| InChIKey | NETSVMOGMLBBAL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |