About 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one
2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (PubChem CID 580606) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
Analyze 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
The IUPAC name of 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one (CID 580606) is 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one.
What is the SMILES notation for 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
The canonical SMILES for 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one is CC(C)(C)C1OC(=O)C2=C(CCCC2)O1.
What is the InChIKey of 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
The InChIKey is CUUUOAYQRVRQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-12(2,3)11-14-9-7-5-4-6-8(9)10(13)15-11/h11H,4-7H2,1-3H3.
What are the key properties of 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one?
2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one has a molecular weight of 210.27 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5,6,7,8-tetrahydro-1,3-benzodioxin-4-one is sourced from PubChem (CID 580606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).