C11H16F2O2 — CID 10704017
trans-ethyl (1R,5R)-3-ethenyl-2,2-difluoro-5-methylcyclopentane-1-carboxylate (PubChem CID 10704017) has the molecular formula C11H16F2O2 and a molecular weight of 218.24 g/mol. Its IUPAC name is trans-ethyl (1R,5R)-3-ethenyl-2,2-difluoro-5-methylcyclopentane-1-carboxylate.
| Compound Name | trans-ethyl (1R,5R)-3-ethenyl-2,2-difluoro-5-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10704017 |
| Molecular Formula | C11H16F2O2 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | trans-ethyl (1R,5R)-3-ethenyl-2,2-difluoro-5-methylcyclopentane-1-carboxylate |
| SMILES | C=CC1C[C@@H](C)[C@H](C(=O)OCC)C1(F)F |
| InChI | InChI=1S/C11H16F2O2/c1-4-8-6-7(3)9(11(8,12)13)10(14)15-5-2/h4,7-9H,1,5-6H2,2-3H3/t7-,8?,9-/m1/s1 |
| InChIKey | AFZFXDJGJZVAQK-PSGOWDBMSA-N |
| XLogP | 2.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|