C10H15N3O4S — CID 107045098
2-(1,1-dioxothiolan-3-yl)-3-(1-methyltriazol-4-yl)propanoic acid (PubChem CID 107045098) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-3-(1-methyltriazol-4-yl)propanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-3-(1-methyltriazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 107045098 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-3-(1-methyltriazol-4-yl)propanoic acid |
| SMILES | Cn1cc(CC(C(=O)O)C2CCS(=O)(=O)C2)nn1 |
| InChI | InChI=1S/C10H15N3O4S/c1-13-5-8(11-12-13)4-9(10(14)15)7-2-3-18(16,17)6-7/h5,7,9H,2-4,6H2,1H3,(H,14,15) |
| InChIKey | JOOMMUNAVQNXFK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |