C8H4Cl2N2S — CID 107051749
5,8-dichloro-1H-quinazoline-4-thione (PubChem CID 107051749) has the molecular formula C8H4Cl2N2S and a molecular weight of 231.11 g/mol. Its IUPAC name is 5,8-dichloro-1H-quinazoline-4-thione.
| Compound Name | 5,8-dichloro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 107051749 |
| Molecular Formula | C8H4Cl2N2S |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 5,8-dichloro-1H-quinazoline-4-thione |
| SMILES | S=c1nc[nH]c2c(Cl)ccc(Cl)c12 |
| InChI | InChI=1S/C8H4Cl2N2S/c9-4-1-2-5(10)7-6(4)8(13)12-3-11-7/h1-3H,(H,11,12,13) |
| InChIKey | SNZSYUAYKJDVQY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|