About 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione
7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione (PubChem CID 95915720) has the molecular formula C13H11N3S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione.
Molecular Properties
| Compound Name | 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione |
| PubChem CID | 95915720 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione |
| SMILES | Cc1ccc(-c2c[nH]c3c(=S)nc[nH]c23)cc1 |
| InChI | InChI=1S/C13H11N3S/c1-8-2-4-9(5-3-8)10-6-14-12-11(10)15-7-16-13(12)17/h2-7,14H,1H3,(H,15,16,17) |
| InChIKey | VOTLWBCTJUTQRO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione?
The IUPAC name of 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione (CID 95915720) is 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione.
What is the SMILES notation for 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione?
The canonical SMILES for 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione is Cc1ccc(-c2c[nH]c3c(=S)nc[nH]c23)cc1.
What is the InChIKey of 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione?
The InChIKey is VOTLWBCTJUTQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3S/c1-8-2-4-9(5-3-8)10-6-14-12-11(10)15-7-16-13(12)17/h2-7,14H,1H3,(H,15,16,17).
What are the key properties of 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione?
7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione has a molecular weight of 241.32 g/mol, XLogP of 3.60, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methylphenyl)-1,5-dihydropyrrolo[3,2-d]pyrimidine-4-thione is sourced from PubChem (CID 95915720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).