C13H12FN3OS — CID 107065642
1-(6-fluoro-1-benzothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol (PubChem CID 107065642) has the molecular formula C13H12FN3OS and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(6-fluoro-1-benzothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol.
| Compound Name | 1-(6-fluoro-1-benzothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107065642 |
| Molecular Formula | C13H12FN3OS |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-(6-fluoro-1-benzothiophen-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)c2cc3ccc(F)cc3s2)nn1 |
| InChI | InChI=1S/C13H12FN3OS/c1-17-7-10(15-16-17)6-11(18)13-4-8-2-3-9(14)5-12(8)19-13/h2-5,7,11,18H,6H2,1H3 |
| InChIKey | RSXSYDVEARMZIU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |