C17H30Si — CID 10706645
[(E)-1-cyclopenta-1,4-dien-1-ylnon-2-en-4-yl]-trimethylsilane (PubChem CID 10706645) has the molecular formula C17H30Si and a molecular weight of 262.51 g/mol. Its IUPAC name is [(E)-1-cyclopenta-1,4-dien-1-ylnon-2-en-4-yl]-trimethylsilane.
| Compound Name | [(E)-1-cyclopenta-1,4-dien-1-ylnon-2-en-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 10706645 |
| Molecular Formula | C17H30Si |
| Molecular Weight | 262.51 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | [(E)-1-cyclopenta-1,4-dien-1-ylnon-2-en-4-yl]-trimethylsilane |
| SMILES | CCCCCC(/C=C/CC1=CCC=C1)[Si](C)(C)C |
| InChI | InChI=1S/C17H30Si/c1-5-6-7-14-17(18(2,3)4)15-10-13-16-11-8-9-12-16/h8,10-12,15,17H,5-7,9,13-14H2,1-4H3/b15-10+ |
| InChIKey | YSDDZEOTTOPQIZ-XNTDXEJSSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|