C9H14S — CID 22555230
2-(1-ethylsulfanylethyl)cyclopenta-1,3-diene (PubChem CID 22555230) has the molecular formula C9H14S and a molecular weight of 154.28 g/mol. Its IUPAC name is 2-(1-ethylsulfanylethyl)cyclopenta-1,3-diene.
| Compound Name | 2-(1-ethylsulfanylethyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 22555230 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 2-(1-ethylsulfanylethyl)cyclopenta-1,3-diene |
| SMILES | CCSC(C)C1=CCC=C1 |
| InChI | InChI=1S/C9H14S/c1-3-10-8(2)9-6-4-5-7-9/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | XURAYVKJNVVFSW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |