C20H21P — CID 135850349
1-cyclopenta-1,4-dien-1-ylpropyl(diphenyl)phosphane (PubChem CID 135850349) has the molecular formula C20H21P and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-ylpropyl(diphenyl)phosphane.
| Compound Name | 1-cyclopenta-1,4-dien-1-ylpropyl(diphenyl)phosphane |
|---|---|
| PubChem CID | 135850349 |
| Molecular Formula | C20H21P |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-ylpropyl(diphenyl)phosphane |
| SMILES | CCC(C1=CCC=C1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21P/c1-2-20(17-11-9-10-12-17)21(18-13-5-3-6-14-18)19-15-7-4-8-16-19/h3-9,11-16,20H,2,10H2,1H3 |
| InChIKey | QEBOFOGWTKEVJI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|