C10H18N+ — CID 137225477
[(1R)-1-cyclopenta-1,4-dien-1-ylethyl]-trimethylazanium (PubChem CID 137225477) has the molecular formula C10H18N+ and a molecular weight of 152.26 g/mol. Its IUPAC name is [(1R)-1-cyclopenta-1,4-dien-1-ylethyl]-trimethylazanium.
| Compound Name | [(1R)-1-cyclopenta-1,4-dien-1-ylethyl]-trimethylazanium |
|---|---|
| PubChem CID | 137225477 |
| Molecular Formula | C10H18N+ |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | [(1R)-1-cyclopenta-1,4-dien-1-ylethyl]-trimethylazanium |
| SMILES | C[C@H](C1=CCC=C1)[N+](C)(C)C |
| InChI | InChI=1S/C10H18N/c1-9(11(2,3)4)10-7-5-6-8-10/h5,7-9H,6H2,1-4H3/q+1/t9-/m1/s1 |
| InChIKey | ARLSHFFSQJCIAD-SECBINFHSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|