C13H19N3O4 — CID 107075942
4-amino-3-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 107075942) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | 4-amino-3-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 107075942 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-amino-3-hydroxy-N-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | COCCNC(=O)C(C)NC(=O)c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C13H19N3O4/c1-8(12(18)15-5-6-20-2)16-13(19)9-3-4-10(14)11(17)7-9/h3-4,7-8,17H,5-6,14H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | UHXDLHUHSQUFMM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|