C16H16BrN3S — CID 107079637
5-(bromomethyl)-6-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)imidazo[2,1-b][1,3]thiazole (PubChem CID 107079637) has the molecular formula C16H16BrN3S and a molecular weight of 362.30 g/mol. Its IUPAC name is 5-(bromomethyl)-6-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 5-(bromomethyl)-6-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 107079637 |
| Molecular Formula | C16H16BrN3S |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 5-(bromomethyl)-6-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)imidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1ccc2c(c1)CCCN2c1nc2sccn2c1CBr |
| InChI | InChI=1S/C16H16BrN3S/c1-11-4-5-13-12(9-11)3-2-6-19(13)15-14(10-17)20-7-8-21-16(20)18-15/h4-5,7-9H,2-3,6,10H2,1H3 |
| InChIKey | FCYHEXOIAZQAQE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|